CymitQuimica logo

CAS 91284-04-7

:

1-(2-chloroprop-2-en-1-yl)-4-methoxybenzene

Description:
1-(2-Chloroprop-2-en-1-yl)-4-methoxybenzene, also known by its CAS number 91284-04-7, is an organic compound characterized by its unique structure that includes a methoxy group and a chloropropenyl substituent. This compound features a benzene ring substituted at the para position with a methoxy group (-OCH3) and at the ortho position with a 2-chloroprop-2-en-1-yl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom introduces electrophilic characteristics, making it a candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group enhances the electron density of the aromatic ring, influencing its reactivity and stability. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and materials science. Its physical properties, such as solubility and boiling point, would depend on the specific molecular interactions and the presence of functional groups. Overall, 1-(2-chloroprop-2-en-1-yl)-4-methoxybenzene is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H11ClO
InChI:InChI=1/C10H11ClO/c1-8(11)7-9-3-5-10(12-2)6-4-9/h3-6H,1,7H2,2H3
SMILES:C=C(Cc1ccc(cc1)OC)Cl
Synonyms:
  • 4-(2-Chloroprop-2-en-1-yl)phenyl methyl ether
  • Benzene, 1-(2-Chloro-2-Propen-1-Yl)-4-Methoxy-
  • 1-(2-Chloroprop-2-en-1-yl)-4-methoxybenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.