CymitQuimica logo

CAS 91284-15-0

:

(2E)-6-amino-5-(4-chlorophenyl)-4-ethyl-2-iminopyrimidin-1(2H)-ol

Description:
(2E)-6-amino-5-(4-chlorophenyl)-4-ethyl-2-iminopyrimidin-1(2H)-ol is a chemical compound characterized by its unique pyrimidine structure, which includes an amino group and an imine functional group. This compound features a 4-chlorophenyl substituent, contributing to its potential biological activity and interaction with various biological targets. The presence of an ethyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The compound's configuration is indicated by the (2E) designation, suggesting a specific geometric arrangement around the imine bond. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific pathways or conditions. The CAS number 91284-15-0 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, this compound's characteristics suggest it may possess interesting pharmacological properties, warranting further investigation in drug development and therapeutic applications.
Formula:C12H13ClN4O
InChI:InChI=1/C12H13ClN4O/c1-2-9-10(7-3-5-8(13)6-4-7)11(14)17(18)12(15)16-9/h3-6,15,18H,2,14H2,1H3/b15-12+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.