CymitQuimica logo

CAS 912844-89-4

:

B-[2-(4-Acetylphenyl)-4-pyridinyl]boronic acid

Description:
B-[2-(4-Acetylphenyl)-4-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a 4-acetylphenyl group, contributing to its unique chemical properties and potential applications in medicinal chemistry and organic synthesis. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, the presence of the acetyl group may influence its solubility and reactivity, while the pyridine ring can participate in various interactions, including hydrogen bonding and coordination with metal ions. Overall, this compound's structural features suggest potential utility in drug development and materials science, particularly in the design of biologically active compounds and functional materials.
Formula:C13H12BNO3
InChI:InChI=1S/C13H12BNO3/c1-9(16)10-2-4-11(5-3-10)13-8-12(14(17)18)6-7-15-13/h2-8,17-18H,1H3
InChI key:InChIKey=ZBGCWVLXBKHLLO-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C(N=CC1)C2=CC=C(C(C)=O)C=C2
Synonyms:
  • B-[2-(4-Acetylphenyl)-4-pyridinyl]boronic acid
  • 2-(4-Acetylphenyl)pyridin-4-ylboronic acid
  • Boronic acid, B-[2-(4-acetylphenyl)-4-pyridinyl]-
  • Boronic acid, [2-(4-acetylphenyl)-4-pyridinyl]-
  • [2-(4-Acetylphenyl)pyridin-4-yl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.