CAS 912849-73-1

32-azido-3,6,9,12,15,18,21,24,27,30-decaoxadotriacontan-1-amine

Description:

The chemical substance known as 32-azido-3,6,9,12,15,18,21,24,27,30-decaoxadotriacontan-1-amine, with the CAS number 912849-73-1, is a complex organic compound characterized by a long carbon chain and multiple ether linkages due to the presence of decaoxadotriacontane structure. The azido group (-N3) introduces unique reactivity, making it useful in various applications, particularly in click chemistry and bioconjugation. The presence of the amine functional group at one end of the molecule suggests potential for further functionalization or interaction with other chemical entities. This compound's long hydrophilic chain may impart solubility in polar solvents, while the azido group can facilitate the formation of covalent bonds with other molecules under appropriate conditions. Overall, its structural features suggest utility in materials science, medicinal chemistry, and nanotechnology, where tailored reactivity and solubility are advantageous. However, specific handling precautions should be observed due to the potentially explosive nature of azides.

Formula: C₂₂H₄₆N₄O₁₀

InChI: InChI=1/C22H46N4O10/c23-1-3-27-5-7-29-9-11-31-13-15-33-17-19-35-21-22-36-20-18-34-16-14-32-12-10-30-8-6-28-4-2-25-26-24/h1-23H2

SMILES: C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[NH-])N

O-(2-Aminoethyl)-O'-(2-azidoethyl)nona(ethylene glycol)

CAS: 912849-73-1

Formula: C₂₂H₄₆N₄O₁₀

Purity: 95%

Color and Shape: Liquid

Molecular weight: 526.6214

Ref: IN-DA003TEO

Azido-PEG10-amine

CAS: 912849-73-1

Azido-PEG10-amine is a non-cleavable ADC linker and PEG-based PROTAC linker.click chemistry alkyne, DBCO or BCN groups.

Formula: C₂₂H₄₆N₄O₁₀

Purity: 98.52%

Color and Shape: Solid

Molecular weight: 526.62

Ref: TM-T14414

Azido-PEG10-amine

CAS: 912849-73-1

Azido-PEG10-amine

Molecular weight: 526.62g/mol

Ref: 54-BIPG1132

O-(2-Aminoethyl)-O'-(2-azidoethyl)nonaethylene glycol

CAS: 912849-73-1

O-(2-Aminoethyl)-O'-(2-azidoethyl)nonaethylene glycol is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. O-(2-Aminoethyl)-O'-(2-azidoethyl)nonaethylene glycol is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₂₂H₄₆N₄O₁₀

Purity: Min. 90%

Color and Shape: Colorless Powder

Molecular weight: 526.62 g/mol

Ref: 3D-FA17749

33-amino-1-(diazyn-1-ium-1-yl)-4,7,10,13,16,19,22,25,28,31-decaoxa-1-azatritriacontan-1-ide

CAS: 912849-73-1

Purity: 97%

Molecular weight: 526.6279907

Ref: 10-F862872

O-(2-Aminoethyl)-O-(2-azidoethyl)nonaethylene Glycol

Controlled Product

CAS: 912849-73-1

Formula: C₂₂H₄₆N₄O₁₀

Color and Shape: Neat

Molecular weight: 526.621

Ref: TR-A608835