CAS 912849-73-1
:32-azido-3,6,9,12,15,18,21,24,27,30-decaoxadotriacontan-1-amine
Description:
The chemical substance known as 32-azido-3,6,9,12,15,18,21,24,27,30-decaoxadotriacontan-1-amine, with the CAS number 912849-73-1, is a complex organic compound characterized by a long carbon chain and multiple ether linkages due to the presence of decaoxadotriacontane structure. The azido group (-N3) introduces unique reactivity, making it useful in various applications, particularly in click chemistry and bioconjugation. The presence of the amine functional group at one end of the molecule suggests potential for further functionalization or interaction with other chemical entities. This compound's long hydrophilic chain may impart solubility in polar solvents, while the azido group can facilitate the formation of covalent bonds with other molecules under appropriate conditions. Overall, its structural features suggest utility in materials science, medicinal chemistry, and nanotechnology, where tailored reactivity and solubility are advantageous. However, specific handling precautions should be observed due to the potentially explosive nature of azides.
Formula:C22H46N4O10
InChI:InChI=1/C22H46N4O10/c23-1-3-27-5-7-29-9-11-31-13-15-33-17-19-35-21-22-36-20-18-34-16-14-32-12-10-30-8-6-28-4-2-25-26-24/h1-23H2
SMILES:C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[NH-])N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
O-(2-Aminoethyl)-O'-(2-azidoethyl)nona(ethylene glycol)
CAS:Formula:C22H46N4O10Purity:95%Color and Shape:LiquidMolecular weight:526.6214Azido-PEG10-amine
CAS:Azido-PEG10-amine is a non-cleavable ADC linker and PEG-based PROTAC linker.click chemistry alkyne, DBCO or BCN groups.Formula:C22H46N4O10Purity:98.52%Color and Shape:SolidMolecular weight:526.62O-(2-Aminoethyl)-O'-(2-azidoethyl)nonaethylene glycol
CAS:O-(2-Aminoethyl)-O'-(2-azidoethyl)nonaethylene glycol is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. O-(2-Aminoethyl)-O'-(2-azidoethyl)nonaethylene glycol is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.Formula:C22H46N4O10Purity:Min. 90%Color and Shape:Colorless PowderMolecular weight:526.62 g/mol33-amino-1-(diazyn-1-ium-1-yl)-4,7,10,13,16,19,22,25,28,31-decaoxa-1-azatritriacontan-1-ide
CAS:Purity:97%Molecular weight:526.6279907O-(2-Aminoethyl)-O-(2-azidoethyl)nonaethylene Glycol
CAS:Controlled ProductFormula:C22H46N4O10Color and Shape:NeatMolecular weight:526.621






