CAS 912895-74-0
:N-(4-hydroxy-2-methylphenyl)methanesulfonamide
Description:
N-(4-hydroxy-2-methylphenyl)methanesulfonamide, with the CAS number 912895-74-0, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a methanesulfonamide moiety attached to a phenolic structure, specifically a 4-hydroxy-2-methylphenyl group. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing its solubility in polar solvents. The methyl group on the aromatic ring can influence the compound's lipophilicity and biological activity. Generally, sulfonamides are recognized for their role in medicinal chemistry, particularly in the development of antimicrobial agents. The specific structural features of this compound may also suggest potential applications in pharmaceuticals, particularly in targeting specific biological pathways. Its stability, reactivity, and interaction with biological systems would depend on various factors, including pH and the presence of other functional groups. Overall, N-(4-hydroxy-2-methylphenyl)methanesulfonamide represents a compound of interest in both synthetic and medicinal chemistry.
Formula:C8H11NO3S
InChI:InChI=1/C8H11NO3S/c1-6-5-7(10)3-4-8(6)9-13(2,11)12/h3-5,9-10H,1-2H3
SMILES:Cc1cc(ccc1NS(=O)(=O)C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
