CAS 912907-08-5

N,4-dimethyl-1-phenylpentan-1-amine

Description:

N,4-dimethyl-1-phenylpentan-1-amine, identified by its CAS number 912907-08-5, is a chemical compound that belongs to the class of amines. It features a pentane backbone with a phenyl group and two methyl groups attached to the nitrogen and carbon atoms, respectively. This structure contributes to its potential as a stimulant, often associated with psychoactive effects. The compound is typically characterized by its relatively low molecular weight and moderate solubility in organic solvents, which is common for amines. Its chemical properties may include basicity due to the presence of the amine functional group, allowing it to participate in various chemical reactions, such as alkylation or acylation. Additionally, the presence of the phenyl group can influence its reactivity and interaction with biological systems. Safety and handling precautions are essential, as with many amines, due to potential toxicity and reactivity. Overall, N,4-dimethyl-1-phenylpentan-1-amine is of interest in both synthetic chemistry and pharmacology.

Formula: C₁₃H₂₁N

InChI: InChI=1/C13H21N/c1-11(2)9-10-13(14-3)12-7-5-4-6-8-12/h4-8,11,13-14H,9-10H2,1-3H3

SMILES: CC(C)CCC(c1ccccc1)NC

Synonyms:

• benzenemethanamine, N-methyl-α-(3-methylbutyl)-
• N,4-Dimethyl-1-phenylpentan-1-amine