CymitQuimica logo

CAS 912969-57-4

:

4-Chloro-N-(4-methylphenyl)-2-thiazolamine

Description:
4-Chloro-N-(4-methylphenyl)-2-thiazolamine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a chloro group and a 4-methylphenyl substituent contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. It is often studied for its potential biological activities, including antimicrobial and antitumor properties, owing to the presence of the thiazole moiety, which is known for its reactivity and ability to form various derivatives. The compound's structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 4-Chloro-N-(4-methylphenyl)-2-thiazolamine represents a class of compounds that can be valuable in pharmaceutical research and development.
Formula:C10H9ClN2S
InChI:InChI=1S/C10H9ClN2S/c1-7-2-4-8(5-3-7)12-10-13-9(11)6-14-10/h2-6H,1H3,(H,12,13)
InChI key:InChIKey=VLQZWCPPDYPJRJ-UHFFFAOYSA-N
SMILES:N(C1=NC(Cl)=CS1)C2=CC=C(C)C=C2
Synonyms:
  • 4-Chloro-N-(4-methylphenyl)-2-thiazolamine
  • 2-Thiazolamine, 4-chloro-N-(4-methylphenyl)-
  • (4-Chlorothiazol-2-yl)-p-tolylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.