CAS 912969-59-6
:4-Chloro-N-(3-methoxyphenyl)-2-thiazolamine
Description:
4-Chloro-N-(3-methoxyphenyl)-2-thiazolamine is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a chloro group at the 4-position and a methoxyphenyl group at the N-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties such as antimicrobial or anticancer activity, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of both electron-withdrawing and electron-donating groups. Additionally, the thiazole moiety is known for its role in various biological systems, which may enhance the compound's interaction with biological targets. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further studies in medicinal chemistry and drug development.
Formula:C10H9ClN2OS
InChI:InChI=1S/C10H9ClN2OS/c1-14-8-4-2-3-7(5-8)12-10-13-9(11)6-15-10/h2-6H,1H3,(H,12,13)
InChI key:InChIKey=IPVZNNIVNOHRCQ-UHFFFAOYSA-N
SMILES:N(C1=CC(OC)=CC=C1)C2=NC(Cl)=CS2
Synonyms:- 4-Chloro-N-(3-methoxyphenyl)-2-thiazolamine
- 2-Thiazolamine, 4-chloro-N-(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
