CymitQuimica logo

CAS 912999-77-0

:

2,3-Bis(bromomethyl)-1,4-difluorobenzene

Description:
2,3-Bis(bromomethyl)-1,4-difluorobenzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two bromomethyl groups and two fluorine atoms. The presence of bromomethyl groups introduces significant reactivity, making it a potential intermediate in various organic synthesis reactions. The difluorobenzene moiety contributes to the compound's unique electronic properties, influencing its reactivity and interactions with other chemical species. This compound is likely to be a solid at room temperature, given the typical properties of similar brominated and fluorinated aromatic compounds. Its molecular structure suggests potential applications in materials science, particularly in the development of polymers or as a building block in pharmaceuticals. Additionally, the presence of halogen substituents may impart specific characteristics such as increased lipophilicity and altered solubility in organic solvents. Safety considerations should be taken into account due to the toxicity associated with brominated compounds and the potential environmental impact of halogenated substances.
Formula:C8H6Br2F2
InChI:InChI=1S/C8H6Br2F2/c9-3-5-6(4-10)8(12)2-1-7(5)11/h1-2H,3-4H2
InChI key:InChIKey=LLDRGWSZEFZZEF-UHFFFAOYSA-N
SMILES:C(Br)C1=C(CBr)C(F)=CC=C1F
Synonyms:
  • Benzene, 2,3-bis(bromomethyl)-1,4-difluoro-
  • 2,3-Bis(bromomethyl)-1,4-difluorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.