CymitQuimica logo

CAS 913002-87-6

:

1-(4-Fluorophenyl)-1H-indazol-4-amine

Description:
1-(4-Fluorophenyl)-1H-indazol-4-amine is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the para position of a phenyl ring, which can influence the compound's electronic properties and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Its structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific pathways or diseases. The amine functional group can participate in hydrogen bonding, enhancing its reactivity and interaction with biological molecules. Overall, 1-(4-Fluorophenyl)-1H-indazol-4-amine is a compound of interest for research in drug discovery and development, particularly in the context of its pharmacological properties and mechanisms of action.
Formula:C13H10FN3
InChI:InChI=1S/C13H10FN3/c14-9-4-6-10(7-5-9)17-13-3-1-2-12(15)11(13)8-16-17/h1-8H,15H2
InChI key:InChIKey=NVGHFZDQPBOQFZ-UHFFFAOYSA-N
SMILES:NC1=C2C(N(N=C2)C3=CC=C(F)C=C3)=CC=C1
Synonyms:
  • 1-(4-Fluorophenyl)-1H-indazol-4-amine
  • 1H-Indazol-4-amine, 1-(4-fluorophenyl)-
  • 1-(4-Fluorophenyl)indazol-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.