CymitQuimica logo

CAS 91312-70-8

:

(cyclohexylmethyl)(triphenyl)phosphonium iodide

Description:
(cyclohexylmethyl)(triphenyl)phosphonium iodide is a quaternary ammonium salt characterized by its phosphonium cation and iodide anion. The structure features a phosphonium center bonded to a cyclohexylmethyl group and three phenyl groups, contributing to its unique properties. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits ionic characteristics due to the presence of the iodide ion, which can influence its reactivity and interactions in various chemical environments. The triphenylphosphonium moiety is known for its ability to facilitate electron transfer processes, making it useful in organic synthesis and as a reagent in various chemical reactions. Additionally, the presence of the cyclohexylmethyl group may impart steric effects that can influence the compound's reactivity and stability. Overall, (cyclohexylmethyl)(triphenyl)phosphonium iodide is a versatile compound with applications in organic chemistry, particularly in the synthesis of phosphonium salts and related derivatives.
Formula:C25H28IP
InChI:InChI=1/C25H28P.HI/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25;/h2-4,7-12,15-20,22H,1,5-6,13-14,21H2;1H/q+1;/p-1
InChI key:WTXJJRORCSDLEF-UHFFFAOYSA-M
SMILES:C1CCC(CC1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[I-]
Found 4 products.