CymitQuimica logo

CAS 91322-00-8

:

5-Amino-2,4,6-trichloropyrimidine

Description:
5-Amino-2,4,6-trichloropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which contains three chlorine substituents at the 2, 4, and 6 positions, along with an amino group at the 5 position. This compound is typically a solid at room temperature and is known for its pale yellow to white crystalline appearance. It is soluble in polar solvents, such as water and alcohols, due to the presence of the amino group, which can engage in hydrogen bonding. The chlorinated nature of the compound contributes to its reactivity, making it useful in various chemical syntheses and applications, particularly in the pharmaceutical and agrochemical industries. Its structure allows for potential interactions with biological systems, which can be explored for developing herbicides or pharmaceuticals. Safety precautions should be taken when handling this compound, as chlorinated compounds can pose environmental and health risks. Overall, 5-Amino-2,4,6-trichloropyrimidine is a significant compound in organic chemistry with diverse applications.
Formula:C4H2Cl3N3
InChI:InChI=1/C4H2Cl3N3/c5-2-1(8)3(6)10-4(7)9-2/h8H2
InChI key:FHBLBGKCJWORQJ-UHFFFAOYSA-N
SMILES:c1(c(Cl)nc(Cl)nc1Cl)N
Synonyms:
  • 2,4,6-Trichloropyrimidin-5-Amine
  • 2,4,6-Trichloro-5-pyrimidinamine
Found 4 products.