CAS 91323-13-6

1H-Imidazole-5-methanol, 4-methyl-, hydrochloride (1:3)

Description:

1H-Imidazole-5-methanol, 4-methyl-, hydrochloride (1:3) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound is often used in various biochemical applications, including as a building block in organic synthesis and in the development of pharmaceuticals. Its imidazole moiety is known for its role in biological systems, particularly in enzyme catalysis and as a component of certain amino acids. The presence of the methyl group at the 4-position of the imidazole ring can influence its reactivity and interaction with biological targets. As with many chemical substances, proper handling and safety precautions should be observed, as it may have specific health and environmental considerations.

Formula: C₅H₈N₂O·3ClH

InChI: InChI=1S/C5H8N2O.3ClH/c1-4-5(2-8)7-3-6-4;;;/h3,8H,2H2,1H3,(H,6,7);3*1H

InChI key: InChIKey=JGHQGKVDINEZAI-UHFFFAOYSA-N

SMILES: C(O)C1=C(C)N=CN1.Cl

Synonyms:

• 1H-Imidazole-4-methanol, 5-methyl-, trihydrochloride
• 1H-Imidazole-5-methanol, 4-methyl-, hydrochloride (1:3)

1H-Imidazole-5-methanol, 4-methyl-, hydrochloride (1:3)

CAS: 91323-13-6

Formula: C₅H₉ClN₂O

Molecular weight: 148.5908

Ref: IN-DA01X3NM