CymitQuimica logo

CAS 91324-40-2

:

3-Ethynyl-1-methylpiperidine

Description:
3-Ethynyl-1-methylpiperidine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of an ethynyl group at the 3-position and a methyl group at the 1-position contributes to its unique properties. This compound is typically a colorless to pale yellow liquid and is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and coupling reactions. The ethynyl group introduces a triple bond, which can participate in further reactions, making it a versatile intermediate in synthetic pathways. Additionally, the nitrogen atom in the piperidine ring can influence the compound's basicity and reactivity. Safety data should be consulted for handling, as with many organic compounds, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C8H13N
InChI:InChI=1S/C8H13N/c1-3-8-5-4-6-9(2)7-8/h1,8H,4-7H2,2H3
InChI key:InChIKey=DKTJIPHWHWSTIG-UHFFFAOYSA-N
SMILES:C(#C)C1CN(C)CCC1
Synonyms:
  • 3-Ethynyl-1-methylpiperidine
  • Piperidine, 3-ethynyl-1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.