CAS 913263-04-4

[difluoro(trimethylsilyl)methyl]phosphonic acid

Description:

[difluoro(trimethylsilyl)methyl]phosphonic acid is a chemical compound characterized by its unique structure, which includes a phosphonic acid functional group and a trimethylsilyl moiety. This compound typically exhibits properties associated with phosphonic acids, such as being a strong acid due to the presence of the phosphonic acid group. The difluoro substituents contribute to its reactivity and potential applications in various chemical reactions, particularly in organophosphorus chemistry. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in synthetic chemistry. Additionally, the presence of fluorine atoms can influence the compound's electronic properties, potentially affecting its interactions with biological systems or other chemical species. Overall, [difluoro(trimethylsilyl)methyl]phosphonic acid is notable for its multifunctionality, which may lend itself to applications in agrochemicals, pharmaceuticals, or materials science, although specific applications would depend on further research and development.

Formula: C₄H₁₁F₂O₃PSi

InChI: InChI=1/C4H11F2O3PSi/c1-11(2,3)4(5,6)10(7,8)9/h1-3H3,(H2,7,8,9)

SMILES: C[Si](C)(C)C(F)(F)P(=O)(O)O

Synonyms:

• Phosphonic Acid, [Difluoro(Trimethylsilyl)Methyl]-

Difluoro(trimethylsilyl)methylphosphonic Acid

Controlled Product

CAS: 913263-04-4

Formula: C₄H₁₁F₂O₃PSi

Color and Shape: Neat

Molecular weight: 204.184

Ref: TR-D458393