CAS 913282-94-7

2,4-Dichloro-5-(4-chlorophenyl)pyrimidine

Description:

2,4-Dichloro-5-(4-chlorophenyl)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features two chlorine substituents at the 2 and 4 positions of the pyrimidine ring, enhancing its reactivity and potential applications in various chemical processes. Additionally, it has a 4-chlorophenyl group attached at the 5 position, which contributes to its lipophilicity and may influence its biological activity. The presence of multiple chlorine atoms suggests that it may exhibit significant stability and resistance to degradation. This compound is often studied for its potential use in agrochemicals, pharmaceuticals, or as an intermediate in organic synthesis. Its properties, such as solubility, melting point, and reactivity, can vary based on environmental conditions and the presence of other chemical species. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.

Formula: C₁₀H₅Cl₃N₂

InChI: InChI=1S/C10H5Cl3N2/c11-7-3-1-6(2-4-7)8-5-14-10(13)15-9(8)12/h1-5H

InChI key: InChIKey=ISVMMUIMZFKVJP-UHFFFAOYSA-N

SMILES: ClC=1C(C2=CC=C(Cl)C=C2)=CN=C(Cl)N1

Synonyms:

• 2,4-Dichloro-5-(4-chlorophenyl)pyrimidine
• Pyrimidine, 2,4-dichloro-5-(4-chlorophenyl)-