CAS 91329-60-1

2-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid

Description:

2-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring. The presence of a carboxylic acid functional group (-COOH) indicates its acidic properties, allowing it to participate in various chemical reactions, such as esterification and acid-base reactions. The compound features a dichlorophenyl substituent, which consists of a phenyl ring with two chlorine atoms at the 3 and 4 positions, contributing to its potential biological activity and lipophilicity. This substitution can influence the compound's reactivity, stability, and interaction with biological targets. Additionally, the presence of chlorine atoms often enhances the compound's potency in pharmaceutical applications. The molecular structure suggests that it may exhibit interesting properties, such as being a potential intermediate in organic synthesis or having applications in agrochemicals or pharmaceuticals. As with many organic acids, it is likely to be soluble in organic solvents and may have limited solubility in water, depending on the pH of the solution.

Formula: C₁₀H₈Cl₂O₂

InChI: InChI=1S/C10H8Cl2O2/c11-8-2-1-5(3-9(8)12)6-4-7(6)10(13)14/h1-3,6-7H,4H2,(H,13,14)

InChI key: InChIKey=HNBMCAXNEUPDCW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C(C1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• Cyclopropanecarboxylic acid, 2-(3,4-dichlorophenyl)-
• 2-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid
• 2-(3,4-Dichlorophenyl)cyclopropane-1-carboxylic acid