CAS 913297-15-1

Benzoic acid, 2-(methylamino)-3-nitro-, methyl ester

Description:

Benzoic acid, 2-(methylamino)-3-nitro-, methyl ester, identified by the CAS number 913297-15-1, is an organic compound characterized by its benzoic acid structure modified with a methylamino group and a nitro group at specific positions on the aromatic ring. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents. The presence of the methylamino group suggests potential basic properties, while the nitro group contributes to its reactivity and may influence its electronic properties. The methyl ester functional group indicates that it can undergo hydrolysis to yield benzoic acid and methanol. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and applications in synthesis. Its specific reactivity and interactions would depend on the functional groups present, making it a candidate for further study in medicinal chemistry and related disciplines. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards.

Formula: C₉H₁₀N₂O₄

InChI: InChI=1S/C9H10N2O4/c1-10-8-6(9(12)15-2)4-3-5-7(8)11(13)14/h3-5,10H,1-2H3

InChI key: InChIKey=PUJFWFKWWCVKMO-UHFFFAOYSA-N

SMILES: N(C)C1=C(C(OC)=O)C=CC=C1N(=O)=O

Synonyms:

• Benzoic acid, 2-(methylamino)-3-nitro-, methyl ester
• Methyl 2-methylamino-3-nitrobenzoate

Methyl 2-(methylamino)-3-nitrobenzoate

CAS: 913297-15-1

Versatile small molecule scaffold

Formula: C₉H₁₀N₂O₄

Purity: Min. 95%

Molecular weight: 210.19 g/mol

Ref: 3D-NLB29715