CymitQuimica logo

CAS 91330-51-7

:

{4-nitro-2-[(4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy}acetic acid

Description:
The chemical substance known as 4-nitro-2-[(4-oxo-2-thioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy}acetic acid, with the CAS number 91330-51-7, exhibits several notable characteristics. It is a complex organic compound featuring a phenoxyacetic acid moiety, which contributes to its potential biological activity. The presence of a nitro group indicates that it may possess unique electronic properties, potentially influencing its reactivity and interactions with biological targets. The thiazolidinone ring structure suggests that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound may exhibit various functional properties, including solubility in organic solvents and potential interactions with enzymes or receptors due to its structural features. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C12H8N2O6S2
InChI:InChI=1/C12H8N2O6S2/c15-10(16)5-20-8-2-1-7(14(18)19)3-6(8)4-9-11(17)13-12(21)22-9/h1-4H,5H2,(H,15,16)(H,13,17,21)
SMILES:c1cc(c(cc1N(=O)=O)C=C1C(=NC(=S)S1)O)OCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.