CAS 91332-09-1

Ethyl 2-amino-1-methyl-1H-benzimidazole-5-carboxylate

Description:

Ethyl 2-amino-1-methyl-1H-benzimidazole-5-carboxylate, with CAS number 91332-09-1, is a chemical compound that belongs to the class of benzimidazole derivatives. This substance features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring, contributing to its biological activity. The presence of an ethyl ester group and an amino group enhances its solubility and reactivity, making it potentially useful in various chemical reactions and applications. The compound is characterized by its ability to form hydrogen bonds due to the amino group, which can influence its interaction with biological targets. Additionally, the methyl group at the 1-position of the benzimidazole ring may affect its steric properties and overall reactivity. Ethyl 2-amino-1-methyl-1H-benzimidazole-5-carboxylate may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₃N₃O₂

InChI: InChI=1S/C11H13N3O2/c1-3-16-10(15)7-4-5-9-8(6-7)13-11(12)14(9)2/h4-6H,3H2,1-2H3,(H2,12,13)

InChI key: InChIKey=OWIZKKSDRKGNBT-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(C(OCC)=O)=CC2)N=C1N

Synonyms:

• 5-Benzimidazolecarboxylic acid, 2-amino-1-methyl-, ethyl ester
• Ethyl 2-amino-1-methyl-1H-benzimidazole-5-carboxylate
• 1H-Benzimidazole-5-carboxylic acid, 2-amino-1-methyl-, ethyl ester