CymitQuimica logo

CAS 913322-60-8

:

4-(4-Fluorophenyl)-5,6-dimethyl-2-pyrimidinamine

Description:
4-(4-Fluorophenyl)-5,6-dimethyl-2-pyrimidinamine, with the CAS number 913322-60-8, is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 2 and 4. The presence of a 4-fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring, which can influence the compound's electronic properties and biological activity. The dimethyl substitutions at positions 5 and 6 of the pyrimidine ring contribute to its steric and electronic characteristics, potentially affecting its solubility and reactivity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of solvents or other reagents.
Formula:C12H12FN3
InChI:InChI=1S/C12H12FN3/c1-7-8(2)15-12(14)16-11(7)9-3-5-10(13)6-4-9/h3-6H,1-2H3,(H2,14,15,16)
InChI key:InChIKey=TWKKOZIKIPZHRG-UHFFFAOYSA-N
SMILES:CC=1C(=NC(N)=NC1C)C2=CC=C(F)C=C2
Synonyms:
  • 2-Pyrimidinamine, 4-(4-fluorophenyl)-5,6-dimethyl-
  • 4-(4-Fluorophenyl)-5,6-dimethyl-2-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.