
CAS 913322-73-3
:4-(5-Bromo-3-pyridinyl)-2-pyrimidinamine
Description:
4-(5-Bromo-3-pyridinyl)-2-pyrimidinamine, with the CAS number 913322-73-3, is a chemical compound characterized by its heterocyclic structure, which includes both pyridine and pyrimidine rings. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in polar solvents and moderate stability under standard conditions. The presence of the bromine substituent on the pyridine ring can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, as many pyrimidine derivatives are known for their roles in pharmaceuticals and agrochemicals. Its molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, 4-(5-Bromo-3-pyridinyl)-2-pyrimidinamine is of interest for its synthetic versatility and potential applications in drug development and research.
Formula:C9H7BrN4
InChI:InChI=1S/C9H7BrN4/c10-7-3-6(4-12-5-7)8-1-2-13-9(11)14-8/h1-5H,(H2,11,13,14)
InChI key:InChIKey=GQVAOWPHRZJSJS-UHFFFAOYSA-N
SMILES:BrC1=CC(=CN=C1)C2=NC(N)=NC=C2
Synonyms:- 4-(5-Bromo-3-pyridinyl)-2-pyrimidinamine
- 2-Pyrimidinamine, 4-(5-bromo-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.