
CAS 913322-74-4
:4-(3-Ethyl-2-pyrazinyl)-2-pyrimidinamine
Description:
4-(3-Ethyl-2-pyrazinyl)-2-pyrimidinamine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a pyrazine moiety. This compound features an ethyl group attached to the pyrazine nitrogen, contributing to its overall hydrophobic character. It is typically classified as an organic heterocyclic compound due to the presence of nitrogen atoms in its ring structures. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the presence of functional groups in its structure may influence its interactions with biological targets, potentially leading to applications in therapeutic contexts. As with many organic compounds, safety data and handling precautions should be considered, particularly in laboratory settings. Overall, 4-(3-Ethyl-2-pyrazinyl)-2-pyrimidinamine represents a class of compounds that may have significant implications in pharmaceutical research.
Formula:C10H11N5
InChI:InChI=1S/C10H11N5/c1-2-7-9(13-6-5-12-7)8-3-4-14-10(11)15-8/h3-6H,2H2,1H3,(H2,11,14,15)
InChI key:InChIKey=YDDJUWLWIRIXBK-UHFFFAOYSA-N
SMILES:C(C)C=1C(=NC=CN1)C2=NC(N)=NC=C2
Synonyms:- 4-(3-Ethyl-2-pyrazinyl)-2-pyrimidinamine
- 2-Pyrimidinamine, 4-(3-ethylpyrazinyl)-
- 2-Pyrimidinamine, 4-(3-ethyl-2-pyrazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.