
CAS 913322-76-6
:4-(3-Ethyl-2-pyrazinyl)-6-methyl-2-pyrimidinamine
Description:
4-(3-Ethyl-2-pyrazinyl)-6-methyl-2-pyrimidinamine is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with both a pyrazine moiety and an ethyl group. This compound typically exhibits properties common to heterocyclic amines, such as moderate solubility in polar solvents and potential biological activity due to its nitrogen-containing rings. The presence of multiple functional groups suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can influence its reactivity and stability. Additionally, compounds of this nature are often investigated for their pharmacological properties, including potential roles as pharmaceuticals or agrochemicals. The specific arrangement of substituents can significantly affect the compound's electronic properties, making it of interest in medicinal chemistry and drug design. Overall, 4-(3-Ethyl-2-pyrazinyl)-6-methyl-2-pyrimidinamine represents a class of compounds that may have diverse applications in various fields, including biochemistry and material science.
Formula:C11H13N5
InChI:InChI=1S/C11H13N5/c1-3-8-10(14-5-4-13-8)9-6-7(2)15-11(12)16-9/h4-6H,3H2,1-2H3,(H2,12,15,16)
InChI key:InChIKey=HSLYYSQYTUPHFU-UHFFFAOYSA-N
SMILES:C(C)C=1C(C=2C=C(C)N=C(N)N2)=NC=CN1
Synonyms:- 4-(3-Ethyl-2-pyrazinyl)-6-methyl-2-pyrimidinamine
- 2-Pyrimidinamine, 4-(3-ethyl-2-pyrazinyl)-6-methyl-
- 2-Pyrimidinamine, 4-(3-ethylpyrazinyl)-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.