CymitQuimica logo

CAS 91335-51-2

:

2-bromo-4,5-diethoxybenzaldehyde

Description:
2-Bromo-4,5-diethoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and two ethoxy substituents on the benzene ring. The presence of the bromine atom at the 2-position and the ethoxy groups at the 4 and 5 positions contribute to its unique reactivity and physical properties. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water due to its hydrophobic ethoxy groups. The compound can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition, making it useful in synthetic organic chemistry. Additionally, its structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C11H13BrO3
InChI:InChI=1/C11H13BrO3/c1-3-14-10-5-8(7-13)9(12)6-11(10)15-4-2/h5-7H,3-4H2,1-2H3
SMILES:CCOc1cc(C=O)c(cc1OCC)Br
Synonyms:
  • Benzaldehyde, 2-Bromo-4,5-Diethoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.