CymitQuimica logo

CAS 91335-52-3

:

3-Bromo-5-methoxy-4-propoxybenzaldehyde

Description:
3-Bromo-5-methoxy-4-propoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. The presence of a bromine atom at the 3-position, a methoxy group (-OCH3) at the 5-position, and a propoxy group (-OCH2CH2CH3) at the 4-position of the benzene ring contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of both the aldehyde and ether functional groups, influencing its solubility in various organic solvents. The bromine substituent can also impart specific reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitutions or coupling reactions. Additionally, the methoxy and propoxy groups can affect the compound's electronic properties and steric hindrance, which may influence its reactivity and interactions with other molecules. Overall, 3-Bromo-5-methoxy-4-propoxybenzaldehyde is a versatile compound that may find applications in organic synthesis and medicinal chemistry.
Formula:C11H13BrO3
InChI:InChI=1S/C11H13BrO3/c1-3-4-15-11-9(12)5-8(7-13)6-10(11)14-2/h5-7H,3-4H2,1-2H3
InChI key:InChIKey=VLLHMUJXHUSCNF-UHFFFAOYSA-N
SMILES:O(C)C1=C(OCCC)C(Br)=CC(C=O)=C1
Synonyms:
  • 3-Bromo-5-methoxy-4-propoxy-benzaldehyde
  • Benzaldehyde, 3-Bromo-5-Methoxy-4-Propoxy-
  • 3-Bromo-5-methoxy-4-propoxybenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.