CymitQuimica logo

CAS 91338-37-3

:

2-ethyl-4-hydroxy-N'-[(E)-(5-nitrofuran-2-yl)methylidene]butanehydrazide

Description:
2-Ethyl-4-hydroxy-N'-[(E)-(5-nitrofuran-2-yl)methylidene]butanehydrazide is a chemical compound characterized by its complex structure, which includes a hydrazide functional group, a nitrofuran moiety, and a hydroxy group. This compound typically exhibits properties associated with both hydrazides and nitro compounds, such as potential biological activity and reactivity due to the presence of the nitro group, which can participate in various chemical reactions. The hydroxy group may contribute to hydrogen bonding, influencing solubility and reactivity. The presence of the ethyl group and the butane chain can affect the compound's lipophilicity and overall stability. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties. However, specific characteristics such as melting point, solubility, and spectral data would require empirical measurement or literature reference for precise values. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with nitro-containing compounds.
Formula:C11H15N3O5
InChI:InChI=1/C11H15N3O5/c1-2-8(5-6-15)11(16)13-12-7-9-3-4-10(19-9)14(17)18/h3-4,7-8,15H,2,5-6H2,1H3,(H,13,16)/b12-7+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.