CymitQuimica logo

CAS 913388-57-5

:

1-(1,1-Dimethylethyl) 2-borono-5-[(4-methyl-1-piperazinyl)carbonyl]-1H-indole-1-carboxylate

Description:
1-(1,1-Dimethylethyl) 2-borono-5-[(4-methyl-1-piperazinyl)carbonyl]-1H-indole-1-carboxylate, with CAS number 913388-57-5, is a chemical compound characterized by its complex structure, which includes an indole core, a boron functional group, and a piperazine moiety. This compound is typically utilized in medicinal chemistry and drug development due to its potential biological activity. The presence of the boron atom suggests possible applications in boron neutron capture therapy or as a building block in organic synthesis. The indole structure is known for its role in various biological processes and can exhibit diverse pharmacological properties. Additionally, the piperazine ring contributes to the compound's solubility and interaction with biological targets. Overall, this compound's unique combination of functional groups may confer specific reactivity and biological activity, making it a subject of interest in pharmaceutical research. However, detailed studies on its efficacy, safety, and mechanism of action would be necessary to fully understand its potential applications.
Formula:C19H26BN3O5
InChI:InChI=1S/C19H26BN3O5/c1-19(2,3)28-18(25)23-15-6-5-13(11-14(15)12-16(23)20(26)27)17(24)22-9-7-21(4)8-10-22/h5-6,11-12,26-27H,7-10H2,1-4H3
InChI key:InChIKey=LBGDJMZIAMJAMK-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C=C1B(O)O)=CC(C(=O)N3CCN(C)CC3)=CC2
Synonyms:
  • 1H-Indole-1-carboxylic acid, 2-borono-5-[(4-methyl-1-piperazinyl)carbonyl]-, 1-(1,1-dimethylethyl) ester
  • 1-(1,1-Dimethylethyl) 2-borono-5-[(4-methyl-1-piperazinyl)carbonyl]-1H-indole-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.