CymitQuimica logo

CAS 91339-01-4

:

1-(4-propylphenyl)ethanamine

Description:
1-(4-Propylphenyl)ethanamine, also known as 4-Propyl-phenethylamine, is an organic compound characterized by its amine functional group attached to an ethyl chain and a propyl-substituted phenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the amine group. The compound may have applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals or as a building block for more complex molecules. Its structure suggests potential interactions with biological systems, which could lead to various pharmacological effects. However, specific biological activity, toxicity, and safety profiles would require further investigation through empirical studies. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Proper handling and storage conditions are essential to ensure safety and stability.
Formula:C11H17N
InChI:InChI=1/C11H17N/c1-3-4-10-5-7-11(8-6-10)9(2)12/h5-9H,3-4,12H2,1-2H3
SMILES:CCCc1ccc(cc1)C(C)N
Synonyms:
  • Benzenemethanamine, alpha-methyl-4-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.