CymitQuimica logo

CAS 91339-50-3

:

2-(2,4,6-trimethylphenoxy)ethanamine

Description:
2-(2,4,6-trimethylphenoxy)ethanamine, identified by its CAS number 91339-50-3, is an organic compound characterized by its amine functional group and ether linkage. This substance features a phenoxy group derived from 2,4,6-trimethylphenol, which contributes to its hydrophobic properties due to the presence of multiple methyl groups on the aromatic ring. The ethanamine portion of the molecule indicates that it contains a two-carbon ethyl chain attached to the amine, which can influence its solubility and reactivity. Typically, compounds like this may exhibit moderate to low solubility in water, while being more soluble in organic solvents. The presence of the amine group suggests potential basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the structural features may impart specific biological activities, making it of interest in pharmaceutical and agrochemical research. Overall, the characteristics of this compound make it a subject of interest in various fields, including organic synthesis and medicinal chemistry.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-8-6-9(2)11(10(3)7-8)13-5-4-12/h6-7H,4-5,12H2,1-3H3
SMILES:Cc1cc(C)c(c(C)c1)OCCN
Synonyms:
  • Ethanamine, 2-(2,4,6-Trimethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.