
CAS 91339-75-2
:2-[2-(Dimethylamino)propyl]phenol
Description:
2-[2-(Dimethylamino)propyl]phenol, also known by its CAS number 91339-75-2, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a phenyl ring. This compound features a dimethylamino group, which contributes to its basicity and potential as a nucleophile in various chemical reactions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the dimethylamino group enhances its solubility in polar solvents, making it useful in various applications, including as an intermediate in organic synthesis and in the formulation of pharmaceuticals. Additionally, its phenolic nature may impart antioxidant properties, which can be beneficial in certain formulations. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, 2-[2-(Dimethylamino)propyl]phenol is a versatile compound with significant relevance in chemical research and industrial applications.
Formula:C11H17NO
InChI:InChI=1S/C11H17NO/c1-9(12(2)3)8-10-6-4-5-7-11(10)13/h4-7,9,13H,8H2,1-3H3
InChI key:InChIKey=NOSUUDNWGFFOOL-UHFFFAOYSA-N
SMILES:C(C(N(C)C)C)C1=C(O)C=CC=C1
Synonyms:- 2-[2-(Dimethylamino)propyl]phenol
- Phenol, 2-[2-(dimethylamino)propyl]-
- Phenol, o-[2-(dimethylamino)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.