CAS 91340-38-4
:3-(2-Methoxyphenoxy)-N-methyl-1-propanamine
Description:
3-(2-Methoxyphenoxy)-N-methyl-1-propanamine, with the CAS number 91340-38-4, is an organic compound characterized by its amine functional group and ether linkage. This substance features a propanamine backbone, which is substituted with a methoxyphenoxy group, contributing to its unique chemical properties. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic amine functionalities. Its structure suggests potential applications in pharmaceuticals or as a chemical intermediate, particularly in the synthesis of more complex molecules. Additionally, the compound's properties, such as melting point, boiling point, and reactivity, would be influenced by its molecular structure and the presence of functional groups. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure or reactivity.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c1-12-8-5-9-14-11-7-4-3-6-10(11)13-2/h3-4,6-7,12H,5,8-9H2,1-2H3
InChI key:InChIKey=NAEGOUYWCNHQGW-UHFFFAOYSA-N
SMILES:O(CCCNC)C1=C(OC)C=CC=C1
Synonyms:- 3-(2-Methoxyphenoxy)-N-methyl-1-propanamine
- 1-Propanamine, 3-(2-methoxyphenoxy)-N-methyl-
- [3-(2-Methoxy-phenoxy)-propyl]-methyl-amine
- [3-(2-Methoxyphenoxy)propyl](methyl)amine
- Propylamine, 3-(o-methoxyphenoxy)-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
