CAS 91347-99-8
:4-(4-Bromophenyl)-1,2,3,6-tetrahydropyridine
Description:
4-(4-Bromophenyl)-1,2,3,6-tetrahydropyridine is an organic compound characterized by its tetrahydropyridine ring structure, which is a saturated six-membered ring containing one nitrogen atom. The presence of a bromophenyl group at the 4-position of the tetrahydropyridine contributes to its unique chemical properties, including potential reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it could participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, due to the electron-withdrawing nature of the bromine atom. Additionally, compounds of this type may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, as they can interact with biological targets. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 4-(4-Bromophenyl)-1,2,3,6-tetrahydropyridine is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H12BrN
InChI:InChI=1/C11H12BrN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2
SMILES:c1cc(ccc1C1=CCNCC1)Br
Synonyms:- Pyridine, 4-(4-Bromophenyl)-1,2,3,6-Tetrahydro-
- 4-bromo-1-phenyl-3,6-dihydro-2H-pyridine
- 4-(4-BROMO-PHENYL)-1,2,3,6-TETRAHYDRO-PYRIDINE
- 4-BROMOPHENYL-1,2,3,6-TETRAHYDROPYRIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
