
CAS 91349-19-8
:(3R)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carboxylate
Description:
The chemical substance known as (3R)-1-(2-chlorophenyl)-5-oxopyrrolidine-3-carboxylate, with the CAS number 91349-19-8, is a pyrrolidine derivative characterized by its unique structural features. This compound contains a pyrrolidine ring, which is a five-membered cyclic amine, and is substituted with a 2-chlorophenyl group, contributing to its aromatic properties. The presence of a carbonyl group (oxopyrrolidine) and a carboxylate moiety indicates that it has both ketone and carboxylic acid functionalities, which can influence its reactivity and solubility. The stereochemistry at the 3-position (3R) suggests that it has a specific three-dimensional arrangement, which may affect its biological activity and interactions with other molecules. This compound may be of interest in medicinal chemistry and pharmacology due to its potential therapeutic applications, particularly in the development of drugs targeting various biological pathways. Its properties, such as solubility, stability, and reactivity, would be influenced by the presence of the chlorophenyl group and the functional groups attached to the pyrrolidine ring.
Formula:C11H9ClNO3
InChI:InChI=1/C11H10ClNO3/c12-8-3-1-2-4-9(8)13-6-7(11(15)16)5-10(13)14/h1-4,7H,5-6H2,(H,15,16)/p-1/t7-/m1/s1
SMILES:c1ccc(c(c1)Cl)N1C[C@@H](CC1=O)C(=O)[O-]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Chlorophenyl)-5-oxopyrrolidine-3-carboxylic acid
CAS:Formula:C11H10ClNO3Molecular weight:239.6550
