CAS 91349-33-6

4-(chloromethyl)-2-(2-methylphenyl)-1,3-thiazole

Description:

4-(Chloromethyl)-2-(2-methylphenyl)-1,3-thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a chloromethyl group indicates that a chlorine atom is attached to a carbon that is also bonded to a methyl group, contributing to its reactivity and potential applications in organic synthesis. The compound also features a 2-methylphenyl group, which enhances its hydrophobic character and may influence its biological activity. This compound may exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity with nucleophiles due to the electrophilic nature of the chloromethyl group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as an intermediate in chemical synthesis. However, specific physical properties like melting point, boiling point, and spectral data would need to be referenced from experimental studies or databases for precise characterization.

Formula: C₁₁H₁₀ClNS

InChI: InChI=1/C11H10ClNS/c1-8-4-2-3-5-10(8)11-13-9(6-12)7-14-11/h2-5,7H,6H2,1H3

SMILES: Cc1ccccc1c1nc(CCl)cs1

Synonyms:

• Thiazole, 4-(Chloromethyl)-2-(2-Methylphenyl)-

4-(Chloromethyl)-2-(2-methylphenyl)-1,3-thiazole

CAS: 91349-33-6

Formula: C₁₁H₁₀ClNS

Molecular weight: 223.7218

Ref: IN-DA006NRJ

4-(chloromethyl)-2-(2-methylphenyl)-1,3-thiazole

CAS: 91349-33-6

Formula: C₁₁H₁₀ClNS

Purity: 95.0%

Molecular weight: 223.72

Ref: 10-F307668