CAS 913574-42-2

N-(1-{2,2-Difluoro-2-[4-(trifluoromethyl)phenyl]ethyl}-4-piperidinyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

N-(1-{2,2-Difluoro-2-[4-(trifluoromethyl)phenyl]ethyl}-4-piperidinyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a synthetic organic compound characterized by its complex structure, which includes a pyrazolo[3,4-d]pyrimidine core, a piperidine ring, and multiple fluorinated aromatic substituents. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where it may serve as a lead compound for the development of pharmaceuticals targeting specific biological pathways. The presence of fluorine atoms enhances its lipophilicity and metabolic stability, which can influence its pharmacokinetic properties. Additionally, the compound's structural features suggest it may interact with various biological targets, making it of interest in drug discovery. Its CAS number, 913574-42-2, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound exemplifies the trend of incorporating fluorinated groups in drug design to improve efficacy and selectivity.

Formula: C₁₉H₁₉F₅N₆

InChI: InChI=1S/C19H19F5N6/c20-18(21,12-1-3-13(4-2-12)19(22,23)24)10-30-7-5-14(6-8-30)28-16-15-9-27-29-17(15)26-11-25-16/h1-4,9,11,14H,5-8,10H2,(H2,25,26,27,28,29)

SMILES: c1cc(ccc1C(CN1CCC(CC1)N=c1c2c[nH][nH]c2ncn1)(F)F)C(F)(F)F