CAS 913613-85-1
:7-Hydroxy-3-methyl-2(1H)-quinolinone
Description:
7-Hydroxy-3-methyl-2(1H)-quinolinone, also known by its CAS number 913613-85-1, is a chemical compound that belongs to the class of quinolinones, which are heterocyclic compounds containing a fused benzene and pyridine ring. This particular compound features a hydroxyl group at the 7-position and a methyl group at the 3-position of the quinolinone structure, contributing to its unique chemical properties. It is typically characterized by its ability to form chelates with metal ions, which can enhance its biological activity. The compound may exhibit various biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and pH conditions, which are important factors to consider in applications. Additionally, the presence of functional groups in its structure allows for potential modifications that can lead to the development of derivatives with enhanced efficacy or specificity for targeted applications.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c1-6-4-7-2-3-8(12)5-9(7)11-10(6)13/h2-5,12H,1H3,(H,11,13)
InChI key:InChIKey=ZXCZSWCMYDJYDC-UHFFFAOYSA-N
SMILES:O=C1NC=2C(C=C1C)=CC=C(O)C2
Synonyms:- 3-Methylquinoline-2,7-diol
- 7-Hydroxy-3-methyl-2(1H)-quinolinone
- 2(1H)-Quinolinone, 7-hydroxy-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
