CAS 913643-31-9

Benzenebutanol, 4-hydroxy-δ-(4-hydroxy-3-methoxyphenyl)-3-methoxy-β,γ-dimethyl-

Description:

Benzenebutanol, 4-hydroxy-δ-(4-hydroxy-3-methoxyphenyl)-3-methoxy-β,γ-dimethyl- is a complex organic compound characterized by its multi-functional groups, including hydroxyl (-OH) and methoxy (-OCH₃) groups, which contribute to its solubility and reactivity. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which can influence its physical properties and biological activity. This compound may exhibit antioxidant properties due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. Its structure indicates potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would depend on further empirical studies. The compound's molecular weight, melting point, and solubility characteristics would be essential for practical applications and would typically be determined through experimental methods. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information. Overall, the unique structural features of this compound suggest a diverse range of potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₂₀H₂₆O₅

InChI: InChI=1S/C20H26O5/c1-12(11-21)13(2)20(14-5-7-16(22)18(9-14)24-3)15-6-8-17(23)19(10-15)25-4/h5-10,12-13,20-23H,11H2,1-4H3

InChI key: InChIKey=BVFKMONTRIVXBO-UHFFFAOYSA-N

SMILES: C(C(C(CO)C)C)(C1=CC(OC)=C(O)C=C1)C2=CC(OC)=C(O)C=C2

Synonyms:

• Benzenebutanol, 4-hydroxy-δ-(4-hydroxy-3-methoxyphenyl)-3-methoxy-β,γ-dimethyl-
• 4,4-Di(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutanol
• 4,4-Bis(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutanol

4,4-di(4-hydroxy-3-methoxyphenly)-2,3-dimethylbutanol

CAS: 913643-31-9

4,4-di(4-Hydroxy-3-methoxyphenly)-2,3-dimethylbutanol has antioxidant and potential cytotoxic abilities, it also shows inhibition against HIV-1 integrase.

Formula: C₂₀H₂₆O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 346.42

Ref: TM-TN6518

4,4-Di(4-hydroxy-3-methoxyphenly)-2,3-dimethylbutanol

CAS: 913643-31-9

4,4-Di(4-hydroxy-3-methoxyphenyl)-2,3-dimethylbutanol is a synthetic lignan derivative, which is an analog of naturally occurring lignans found in various plants. This compound is synthesized through chemical modification of specific lignan structures to enhance its stability and bioactivity. The mode of action of this substance is primarily associated with its antioxidant properties, effectively scavenging free radicals and reducing oxidative stress at the cellular level. This function can mitigate the effects of oxidative damage in biological systems.

Formula: C₂₀H₂₆O₅

Purity: Min. 95%

Molecular weight: 346.4 g/mol

Ref: 3D-NLB64331