CymitQuimica logo

CAS 913645-28-0

:

ethyl 1,4-diazepan-1-ylacetate

Description:
Ethyl 1,4-diazepan-1-ylacetate is a chemical compound characterized by its unique structure, which includes a diazepane ring—a seven-membered cyclic structure containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. Typically, compounds like ethyl 1,4-diazepan-1-ylacetate exhibit moderate polarity due to the presence of both hydrophobic (ethyl group) and hydrophilic (acetate and nitrogen atoms) components. The diazepane ring can influence the compound's biological activity, potentially interacting with various receptors or enzymes in biological systems. Additionally, the presence of the acetate group may enhance its solubility in organic solvents, making it useful in various chemical applications, including synthesis and medicinal chemistry. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety data and handling precautions should be considered, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H18N2O2
InChI:InChI=1/C9H18N2O2/c1-2-13-9(12)8-11-6-3-4-10-5-7-11/h10H,2-8H2,1H3
SMILES:CCOC(=O)CN1CCCNCC1
Synonyms:
  • 1H-1,4-diazepine-1-acetic acid, hexahydro-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.