CymitQuimica logo

CAS 91366-64-2

:

7-fluoro-2,1,3-benzoxadiazole-4-sulfonyl chloride

Description:
7-Fluoro-2,1,3-benzoxadiazole-4-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a benzoxadiazole ring substituted with a fluorine atom and a sulfonyl chloride group. This compound is typically used in organic synthesis and medicinal chemistry due to its reactive sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions. The presence of the fluorine atom enhances its electronic properties, potentially influencing its reactivity and biological activity. It is generally a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage conditions. The sulfonyl chloride group makes it a useful intermediate for the synthesis of various sulfonamide derivatives and other functionalized compounds. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose hazards such as irritation to skin and eyes, and it may release toxic gases upon decomposition.
Formula:C6H2ClFN2O3S
InChI:InChI=1/C6H2ClFN2O3S/c7-14(11,12)4-2-1-3(8)5-6(4)10-13-9-5/h1-2H
SMILES:c1cc(c2c(c1F)non2)S(=O)(=O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.