CAS 91367-05-4
:Benzoic acid, 4-chloro-3-methyl-, methyl ester
Description:
Benzoic acid, 4-chloro-3-methyl-, methyl ester, identified by the CAS number 91367-05-4, is an organic compound characterized by its ester functional group. It is derived from benzoic acid, with a methyl group and a chlorine atom substituted on the aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic esters. The presence of the chlorine atom can impart unique reactivity and influence the compound's physical properties, such as boiling and melting points. Additionally, this compound may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose environmental and health risks. Overall, benzoic acid, 4-chloro-3-methyl-, methyl ester is a notable compound in organic chemistry with potential applications in synthesis and research.
Formula:C9H9ClO2
InChI:InChI=1S/C9H9ClO2/c1-6-5-7(9(11)12-2)3-4-8(6)10/h3-5H,1-2H3
InChI key:InChIKey=QOTGNXMPQNGYDM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(C)=C(Cl)C=C1
Synonyms:- 4-Chloro-3-methylbenzoic acid methyl ester
- 4-Chloro-3-methylbenzoic acid methyl ester~4-Chloro-m-toluic acid methyl ester
- Benzoic acid, 4-chloro-3-methyl-, methyl ester
- m-Toluic acid, 4-chloro-, methyl ester
- Methyl 4-chloro-3-methylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4-chloro-3-methylbenzoate
CAS:Formula:C9H9ClO2Purity:97%Color and Shape:SolidMolecular weight:184.6196Methyl 4-Chloro-3-methylbenzoate
CAS:Formula:C9H9ClO2Purity:>98.0%(GC)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:184.62Methyl 4-chloro-3-methylbenzoate
CAS:Methyl 4-chloro-3-methylbenzoateFormula:C9H9ClO2Purity:98%Color and Shape: orange liquidMolecular weight:184.62g/molMethyl 4-chloro-3-methylbenzoate
CAS:<p>Please enquire for more information about Methyl 4-chloro-3-methylbenzoate including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C9H9ClO2Purity:Min. 95%Molecular weight:184.62 g/molMethyl 4-chloro-3-methylbenzoate
CAS:Formula:C9H9ClO2Purity:98%Color and Shape:ClearMolecular weight:184.62




