
CAS 91368-55-7
:[1,1′-Biphenyl]-2,2′,3-triol
Description:
[1,1′-Biphenyl]-2,2′,3-triol, also known by its CAS number 91368-55-7, is an organic compound characterized by its biphenyl structure with three hydroxyl (-OH) groups attached at the 2, 2', and 3 positions. This triol exhibits properties typical of phenolic compounds, including potential antioxidant activity due to the presence of multiple hydroxyl groups, which can donate hydrogen atoms and stabilize free radicals. The compound is likely to be soluble in polar solvents due to its hydroxyl groups, while its biphenyl backbone may impart some hydrophobic characteristics. It may also participate in various chemical reactions, such as esterification or etherification, due to its reactive hydroxyl groups. Additionally, the compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific biological activities, toxicity, and environmental impact would require further investigation to fully understand its implications in practical applications.
Formula:C12H10O3
InChI:InChI=1S/C12H10O3/c13-10-6-2-1-4-8(10)9-5-3-7-11(14)12(9)15/h1-7,13-15H
InChI key:InChIKey=USBNIYMZDQVDSO-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1O)C2=C(O)C=CC=C2
Synonyms:- [1,1′-Biphenyl]-2,2′,3-triol
- 2,2′,3-Biphenyltriol
- 2,2′,3-Trihydroxybiphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.