CAS 913686-08-5

4-[4-Fluoro-3-(trifluoromethyl)phenyl]-2-thiazolamine

Description:

4-[4-Fluoro-3-(trifluoromethyl)phenyl]-2-thiazolamine is a chemical compound characterized by its unique structural features, which include a thiazole ring and a phenyl group substituted with both a fluorine atom and a trifluoromethyl group. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The trifluoromethyl group enhances lipophilicity and can influence the compound's interaction with biological targets. This compound is likely to exhibit specific reactivity patterns due to the electron-withdrawing nature of the fluorine and trifluoromethyl groups, which can affect its acidity and nucleophilicity. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its CAS number, 913686-08-5, allows for easy identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, this compound represents a class of fluorinated organic molecules with significant implications in chemical research and development.

Formula: C₁₀H₆F₄N₂S

InChI: InChI=1S/C10H6F4N2S/c11-7-2-1-5(3-6(7)10(12,13)14)8-4-17-9(15)16-8/h1-4H,(H2,15,16)

InChI key: InChIKey=KGPBNLSPHADRDS-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1F)C2=CSC(N)=N2

Synonyms:

• [4-(4-Fluoro-3-trifluoromethylphenyl)thiazol-2-yl]amine
• 2-Thiazolamine, 4-[4-fluoro-3-(trifluoromethyl)phenyl]-
• 4-[4-Fluoro-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine
• 4-[4-Fluoro-3-(trifluoromethyl)phenyl]-2-thiazolamine