CAS 91370-48-8
:Ethyl 3-amino-2-cyclohexylpropanoate
Description:
Ethyl 3-amino-2-cyclohexylpropanoate, with the CAS number 91370-48-8, is an organic compound characterized by its ester functional group and the presence of an amino group. This compound features a cyclohexyl ring, which contributes to its hydrophobic properties, while the ethyl ester group enhances its solubility in organic solvents. The amino group introduces basicity and potential for hydrogen bonding, making it a candidate for various chemical reactions, including amide formation and nucleophilic substitutions. Ethyl 3-amino-2-cyclohexylpropanoate may exhibit biological activity, which could be of interest in pharmaceutical applications. Its molecular structure suggests potential uses in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the steric effects of the cyclohexyl group and the electronic effects of the amino group. Overall, this compound represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C11H21NO2
InChI:InChI=1/C11H21NO2/c1-2-14-11(13)10(8-12)9-6-4-3-5-7-9/h9-10H,2-8,12H2,1H3
Synonyms:- Ethyl-3-amino-2-cyclohexylpropanoat
- cyclohexaneacetic acid, α-(aminomethyl)-, ethyl ester
- Ethyl 3-amino-2-cyclohexylpropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
