CAS 91371-14-1
:1,6-dibromooxanthrene
Description:
1,6-Dibromooxanthrene is an organic compound characterized by its structure, which includes a fused ring system containing both bromine substituents and an oxanthrene moiety. This compound typically exhibits properties associated with polycyclic aromatic compounds, such as a planar structure and potential for π-π stacking interactions. The presence of bromine atoms introduces significant electronegativity, which can influence the compound's reactivity and solubility in various solvents. Additionally, the bromine substituents may enhance the compound's photophysical properties, making it of interest in applications such as organic electronics and photonic devices. The compound's stability and behavior under different conditions can be influenced by the bromine atoms, which may also participate in further chemical reactions, such as nucleophilic substitutions. Overall, 1,6-dibromooxanthrene represents a unique class of compounds with potential utility in advanced materials science and organic synthesis.
Formula:C12H6Br2O2
InChI:InChI=1/C12H6Br2O2/c13-7-3-1-5-9-11(7)16-10-6-2-4-8(14)12(10)15-9/h1-6H
SMILES:c1cc(c2c(c1)Oc1c(cccc1O2)Br)Br
Synonyms:- 1,6-Dibromodibenzo-P-Dioxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
