CymitQuimica logo

CAS 91374-24-2

:

Ethyl 2-[2-(dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoate

Description:
Ethyl 2-[2-(dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoate, with CAS number 91374-24-2, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group, a nitro group, and a dipropylamino moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the nitro group suggests it may participate in redox reactions, while the dipropylamino group can influence its solubility and interaction with biological targets. Ethyl esters are generally known for their volatility and potential use in organic synthesis. The compound may also exhibit pharmacological properties, making it of interest in medicinal chemistry. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety data and handling precautions are essential due to potential toxicity or reactivity.
Formula:C19H28N2O5
InChI:InChI=1S/C19H28N2O5/c1-4-11-20(12-5-2)13-10-15-8-7-9-17(21(24)25)16(15)14-18(22)19(23)26-6-3/h7-9H,4-6,10-14H2,1-3H3
InChI key:InChIKey=WOOIUFZMYXSJNR-UHFFFAOYSA-N
SMILES:C(C(C(OCC)=O)=O)C1=C(CCN(CCC)CCC)C=CC=C1N(=O)=O
Synonyms:
  • 2-[2-(Dipropylamino)ethyl]-6-nitro-alpha-oxobenzenepropanoic acid ethyl ester
  • Benzenepropanoic acid, 2-[2-(dipropylamino)ethyl]-6-nitro-α-oxo-, ethyl ester
  • Ethyl 2-[2-(dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoate
  • ethyl 3-{2-[2-(dipropylamino)ethyl]-6-nitrophenyl}-2-oxopropanoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.