CymitQuimica logo

CAS 91374-25-3

:

2-[2-(Dipropylamino)ethyl]-6-nitrophenylacetic acid hydrochloride

Description:
2-[2-(Dipropylamino)ethyl]-6-nitrophenylacetic acid hydrochloride, with the CAS number 91374-25-3, is a chemical compound characterized by its complex structure, which includes a nitrophenyl group, an acetic acid moiety, and a dipropylamino substituent. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in biochemical research and pharmacology. The presence of the nitro group suggests potential reactivity and the ability to participate in electrophilic substitution reactions. The dipropylamino group contributes to its basicity and may influence its interaction with biological systems, potentially affecting its pharmacokinetic properties. As a hydrochloride salt, it is likely to be more stable and easier to handle compared to its free base form. Overall, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development.
Formula:C16H25ClN2O4
InChI:InChI=1/C16H24N2O4.ClH/c1-3-9-17(10-4-2)11-8-13-6-5-7-15(18(21)22)14(13)12-16(19)20;/h5-7H,3-4,8-12H2,1-2H3,(H,19,20);1H
SMILES:CCCN(CCC)CCc1cccc(c1CC(=O)O)N(=O)=O.Cl
Synonyms:
  • 2-(2-N,N-Dipropylaminoethyl)-6-nitrophenyl acetic acid HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.