
CAS 91374-26-4
:2H-Indol-2-one, 4-(2-aminoethyl)-1,3-dihydro-, hydrochloride (1:1)
Description:
2H-Indol-2-one, 4-(2-aminoethyl)-1,3-dihydro-, hydrochloride (1:1), with the CAS number 91374-26-4, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound is characterized by the presence of an aminoethyl side chain at the 4-position of the indole ring, contributing to its potential biological activity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, which often enhances its solubility in water and stability. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, possibly influencing neurotransmitter systems or exhibiting anti-inflammatory effects. As with many indole derivatives, it may also be involved in various biochemical pathways, making it a subject of research in fields such as neuropharmacology and cancer therapy.
Formula:C10H12N2O·ClH
InChI:InChI=1S/C10H12N2O.ClH/c11-5-4-7-2-1-3-9-8(7)6-10(13)12-9;/h1-3H,4-6,11H2,(H,12,13);1H
InChI key:InChIKey=DQDLTRXGDDRNCI-UHFFFAOYSA-N
SMILES:C(CN)C1=C2C(NC(=O)C2)=CC=C1.Cl
Synonyms:- 2-(1H-indol-4-yloxy)ethanamine hydrochloride (1:1)
- 2H-Indol-2-one, 4-(2-aminoethyl)-1,3-dihydro-, hydrochloride (1:1)
- 2H-Indol-2-one, 4-(2-aminoethyl)-1,3-dihydro-, monohydrochloride
- 4-(2-Aminoethyl)-1,3-dihydro-2H-indol-2-one hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(2-Aminoethyl)-1,3-dihydro-2H-indol-2-one Hydrochloride
CAS:Controlled ProductApplications 4-(2-Aminoethyl)-1,3-dihydro-2H-indol-2-one Hydrochloride, can be used for the synthesis of Ropinirole (R641000), which is an antiparkinsonian agent. It is also a selective dopamine D2-receptor agonist.
References Eden, R.J., et al.: Pharmacol. Biochem. Behav., 38, 147 (1991), Rascol, O., et al.: Mov. Disord., 13, 39 (1998),Formula:C10H12N2O·ClHColor and Shape:NeatMolecular weight:212.676

