
CAS 91375-76-7
:8-Hydroxy-2H-1,4-benzothiazin-3(4H)-one
Description:
8-Hydroxy-2H-1,4-benzothiazin-3(4H)-one, with the CAS number 91375-76-7, is a chemical compound characterized by its unique bicyclic structure that incorporates both a benzothiazine and a hydroxyl group. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in medicinal chemistry. The presence of the hydroxyl group contributes to its reactivity and ability to form hydrogen bonds, which can influence its interactions with biological targets. Additionally, the benzothiazine moiety is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 8-Hydroxy-2H-1,4-benzothiazin-3(4H)-one represents a class of compounds that may have significant applications in drug development and therapeutic research.
Formula:C8H7NO2S
InChI:InChI=1S/C8H7NO2S/c10-6-3-1-2-5-8(6)12-4-7(11)9-5/h1-3,10H,4H2,(H,9,11)
InChI key:InChIKey=HHSNRRCSRPQQNP-UHFFFAOYSA-N
SMILES:OC1=C2C(NC(=O)CS2)=CC=C1
Synonyms:- 2H-1,4-Benzothiazin-3(4H)-one, 8-hydroxy-
- 8-Hydroxy-2H-1,4-benzothiazin-3(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.