CAS 913830-32-7

[6-(2-thienyl)-3-pyridyl]methanamine dihydrochloride

Description:

[6-(2-thienyl)-3-pyridyl]methanamine dihydrochloride is a chemical compound characterized by its unique structure, which includes a pyridine ring and a thienyl group. This compound typically appears as a white to off-white crystalline solid, indicating its solid-state at room temperature. It is soluble in water and polar organic solvents, which is common for many amine derivatives. The presence of the dihydrochloride indicates that it forms salts with hydrochloric acid, enhancing its solubility and stability in aqueous environments. The compound may exhibit biological activity, potentially interacting with various receptors or enzymes, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in hydrogen bonding due to the amine group, influencing its reactivity and interactions with other molecules. As with many chemical substances, proper handling and safety measures should be observed, as it may have specific toxicity or reactivity profiles that require attention in laboratory settings.

Formula: C₁₀H₁₂Cl₂N₂S

InChI: InChI=1/C10H10N2S.2ClH/c11-6-8-3-4-9(12-7-8)10-2-1-5-13-10;;/h1-5,7H,6,11H2;2*1H

SMILES: c1cc(c2ccc(CN)cn2)sc1.Cl.Cl

[6-(Thien-2-yl)pyridin-3-yl]methylamine dihydrochloride

CAS: 913830-32-7

[6-(Thien-2-yl)pyridin-3-yl]methylamine dihydrochloride

Purity: 90+%

Color and Shape: Orange Solid

Molecular weight: 263.19g/mol

Ref: 54-OR5209

(6-(Thiophen-2-yl)pyridin-3-yl)methanamine dihydrochloride

CAS: 913830-32-7

Purity: 98%

Molecular weight: 263.1799927

Ref: 10-F777734